C26H38F2N4O2S — CID 118350533
4-(7-fluoro-7-methyloctoxy)-2-(3-fluorophenyl)-5-(4-propan-2-ylsulfanylpiperazin-1-yl)pyridazin-3-one (PubChem CID 118350533) has the molecular formula C26H38F2N4O2S and a molecular weight of 508.68 g/mol. Its IUPAC name is 4-(7-fluoro-7-methyloctoxy)-2-(3-fluorophenyl)-5-(4-propan-2-ylsulfanylpiperazin-1-yl)pyridazin-3-one.
| Compound Name | 4-(7-fluoro-7-methyloctoxy)-2-(3-fluorophenyl)-5-(4-propan-2-ylsulfanylpiperazin-1-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 118350533 |
| Molecular Formula | C26H38F2N4O2S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | 4-(7-fluoro-7-methyloctoxy)-2-(3-fluorophenyl)-5-(4-propan-2-ylsulfanylpiperazin-1-yl)pyridazin-3-one |
| SMILES | CC(C)SN1CCN(c2cnn(-c3cccc(F)c3)c(=O)c2OCCCCCCC(C)(C)F)CC1 |
| InChI | InChI=1S/C26H38F2N4O2S/c1-20(2)35-31-15-13-30(14-16-31)23-19-29-32(22-11-9-10-21(27)18-22)25(33)24(23)34-17-8-6-5-7-12-26(3,4)28/h9-11,18-20H,5-8,12-17H2,1-4H3 |
| InChIKey | VQDUYVQNJSDETB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|