C29H38ClN5O3S — CID 118351046
5-[4-[(3-aminophenyl)methylsulfanyloxy]piperazin-1-yl]-2-(3-chlorophenyl)-4-(2,2-dimethylhexoxy)pyridazin-3-one (PubChem CID 118351046) has the molecular formula C29H38ClN5O3S and a molecular weight of 572.18 g/mol. Its IUPAC name is 5-[4-[(3-aminophenyl)methylsulfanyloxy]piperazin-1-yl]-2-(3-chlorophenyl)-4-(2,2-dimethylhexoxy)pyridazin-3-one.
| Compound Name | 5-[4-[(3-aminophenyl)methylsulfanyloxy]piperazin-1-yl]-2-(3-chlorophenyl)-4-(2,2-dimethylhexoxy)pyridazin-3-one |
|---|---|
| PubChem CID | 118351046 |
| Molecular Formula | C29H38ClN5O3S |
| Molecular Weight | 572.18 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | 5-[4-[(3-aminophenyl)methylsulfanyloxy]piperazin-1-yl]-2-(3-chlorophenyl)-4-(2,2-dimethylhexoxy)pyridazin-3-one |
| SMILES | CCCCC(C)(C)COc1c(N2CCN(OSCc3cccc(N)c3)CC2)cnn(-c2cccc(Cl)c2)c1=O |
| InChI | InChI=1S/C29H38ClN5O3S/c1-4-5-12-29(2,3)21-37-27-26(19-32-35(28(27)36)25-11-7-9-23(30)18-25)33-13-15-34(16-14-33)38-39-20-22-8-6-10-24(31)17-22/h6-11,17-19H,4-5,12-16,20-21,31H2,1-3H3 |
| InChIKey | DGGCNNBDYWCXMX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.18 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|