C8H14IN4O3- — CID 163514736
CID 163514736 (PubChem CID 163514736) has the molecular formula C8H14IN4O3- and a molecular weight of 341.13 g/mol.
| Compound Name | CID 163514736 |
|---|---|
| PubChem CID | 163514736 |
| Molecular Formula | C8H14IN4O3- |
| Molecular Weight | 341.13 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | — |
| SMILES | NCCC(=O)NC(CC1=CN[I-]N1)C(=O)O |
| InChI | InChI=1S/C8H14IN4O3/c10-2-1-7(14)12-6(8(15)16)3-5-4-11-9-13-5/h4,6,11,13H,1-3,10H2,(H,12,14)(H,15,16)/q-1 |
| InChIKey | WABGCYVSTYDBAR-UHFFFAOYSA-N |
| XLogP | -4.75 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.13 |
| LogP ≤ 5 | -4.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|