C9H13ClN4O3 — CID 68621436
2-(3-aminopropanoylamino)-3-(1-chloroimidazol-4-yl)propanoic acid (PubChem CID 68621436) has the molecular formula C9H13ClN4O3 and a molecular weight of 260.68 g/mol. Its IUPAC name is 2-(3-aminopropanoylamino)-3-(1-chloroimidazol-4-yl)propanoic acid.
| Compound Name | 2-(3-aminopropanoylamino)-3-(1-chloroimidazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 68621436 |
| Molecular Formula | C9H13ClN4O3 |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 2-(3-aminopropanoylamino)-3-(1-chloroimidazol-4-yl)propanoic acid |
| SMILES | NCCC(=O)NC(Cc1cn(Cl)cn1)C(=O)O |
| InChI | InChI=1S/C9H13ClN4O3/c10-14-4-6(12-5-14)3-7(9(16)17)13-8(15)1-2-11/h4-5,7H,1-3,11H2,(H,13,15)(H,16,17) |
| InChIKey | OKBPEVUKVRVUNO-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |