C18H22N4O5 — CID 68815720
3-[1-[(2-acetyloxyphenyl)methyl]imidazol-4-yl]-2-(3-aminopropanoylamino)propanoic acid (PubChem CID 68815720) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is 3-[1-[(2-acetyloxyphenyl)methyl]imidazol-4-yl]-2-(3-aminopropanoylamino)propanoic acid.
| Compound Name | 3-[1-[(2-acetyloxyphenyl)methyl]imidazol-4-yl]-2-(3-aminopropanoylamino)propanoic acid |
|---|---|
| PubChem CID | 68815720 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 3-[1-[(2-acetyloxyphenyl)methyl]imidazol-4-yl]-2-(3-aminopropanoylamino)propanoic acid |
| SMILES | CC(=O)Oc1ccccc1Cn1cnc(CC(NC(=O)CCN)C(=O)O)c1 |
| InChI | InChI=1S/C18H22N4O5/c1-12(23)27-16-5-3-2-4-13(16)9-22-10-14(20-11-22)8-15(18(25)26)21-17(24)6-7-19/h2-5,10-11,15H,6-9,19H2,1H3,(H,21,24)(H,25,26) |
| InChIKey | VDRLRTNEDAIKEF-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|