C18H24FN7O2 — CID 163515816
N-[[(5S)-3-[3-fluoro-4-[4-(tetrazol-2-yl)piperidin-1-yl]phenyl]-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 163515816) has the molecular formula C18H24FN7O2 and a molecular weight of 389.44 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-(tetrazol-2-yl)piperidin-1-yl]phenyl]-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-(tetrazol-2-yl)piperidin-1-yl]phenyl]-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 163515816 |
| Molecular Formula | C18H24FN7O2 |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-(tetrazol-2-yl)piperidin-1-yl]phenyl]-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCC(n4ncnn4)CC3)c(F)c2)CO1 |
| InChI | InChI=1S/C18H24FN7O2/c1-13(27)20-9-16-10-25(12-28-16)15-2-3-18(17(19)8-15)24-6-4-14(5-7-24)26-22-11-21-23-26/h2-3,8,11,14,16H,4-7,9-10,12H2,1H3,(H,20,27)/t16-/m0/s1 |
| InChIKey | DGQFNFCLIPYDOW-INIZCTEOSA-N |
| XLogP | 0.95 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|