C22H24FN5O2 — CID 163516575
2-(aminomethylidene)-N-[3-cyano-4-[2-(dimethylamino)ethoxy]phenyl]-3-(4-fluorophenyl)iminobutanamide (PubChem CID 163516575) has the molecular formula C22H24FN5O2 and a molecular weight of 409.47 g/mol. Its IUPAC name is 2-(aminomethylidene)-N-[3-cyano-4-[2-(dimethylamino)ethoxy]phenyl]-3-(4-fluorophenyl)iminobutanamide.
| Compound Name | 2-(aminomethylidene)-N-[3-cyano-4-[2-(dimethylamino)ethoxy]phenyl]-3-(4-fluorophenyl)iminobutanamide |
|---|---|
| PubChem CID | 163516575 |
| Molecular Formula | C22H24FN5O2 |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 2-(aminomethylidene)-N-[3-cyano-4-[2-(dimethylamino)ethoxy]phenyl]-3-(4-fluorophenyl)iminobutanamide |
| SMILES | C/C(=N\c1ccc(F)cc1)C(=CN)C(=O)Nc1ccc(OCCN(C)C)c(C#N)c1 |
| InChI | InChI=1S/C22H24FN5O2/c1-15(26-18-6-4-17(23)5-7-18)20(14-25)22(29)27-19-8-9-21(16(12-19)13-24)30-11-10-28(2)3/h4-9,12,14H,10-11,25H2,1-3H3,(H,27,29)/b20-14?,26-15+ |
| InChIKey | PYOCIDVYYHEKLB-YKSVQXLJSA-N |
| XLogP | 3.21 |
| TPSA | 103.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|