C21H27N3O4 — CID 163516894
6-[4-[[4-[2-hydroxyethyl(methyl)amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]anilino]hexanal (PubChem CID 163516894) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 6-[4-[[4-[2-hydroxyethyl(methyl)amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]anilino]hexanal.
| Compound Name | 6-[4-[[4-[2-hydroxyethyl(methyl)amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]anilino]hexanal |
|---|---|
| PubChem CID | 163516894 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 6-[4-[[4-[2-hydroxyethyl(methyl)amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]anilino]hexanal |
| SMILES | CN(CCO)C1=CC(=O)C(Nc2ccc(NCCCCCC=O)cc2)=CC1=O |
| InChI | InChI=1S/C21H27N3O4/c1-24(11-13-26)19-15-20(27)18(14-21(19)28)23-17-8-6-16(7-9-17)22-10-4-2-3-5-12-25/h6-9,12,14-15,22-23,26H,2-5,10-11,13H2,1H3 |
| InChIKey | DHNGRUHWUMUQHQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|