C29H39ClN2O3 — CID 163517533
2-(6-chloroindazol-2-yl)-1-[(3S,5S,9S,10S,13S,14S,17S)-3-hydroxy-3-methoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 163517533) has the molecular formula C29H39ClN2O3 and a molecular weight of 499.10 g/mol. Its IUPAC name is 2-(6-chloroindazol-2-yl)-1-[(3S,5S,9S,10S,13S,14S,17S)-3-hydroxy-3-methoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-(6-chloroindazol-2-yl)-1-[(3S,5S,9S,10S,13S,14S,17S)-3-hydroxy-3-methoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 163517533 |
| Molecular Formula | C29H39ClN2O3 |
| Molecular Weight | 499.10 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 2-(6-chloroindazol-2-yl)-1-[(3S,5S,9S,10S,13S,14S,17S)-3-hydroxy-3-methoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CO[C@@]1(O)CC[C@@]2(C)[C@@H](CCC3[C@@H]2CC[C@]2(C)[C@@H](C(=O)Cn4cc5ccc(Cl)cc5n4)CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H39ClN2O3/c1-27-12-13-29(34,35-3)15-19(27)5-7-21-22-8-9-24(28(22,2)11-10-23(21)27)26(33)17-32-16-18-4-6-20(30)14-25(18)31-32/h4,6,14,16,19,21-24,34H,5,7-13,15,17H2,1-3H3/t19-,21?,22-,23-,24+,27-,28-,29-/m0/s1 |
| InChIKey | DIAFSYZNNUAYGZ-VVANWKJISA-N |
| XLogP | 6.25 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.10 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|