C20H22F2N4O — CID 163519753
N-(4,4-difluorocyclohexyl)-1-[(2E,4Z)-1-iminohexa-2,4-dien-3-yl]imidazo[1,5-a]pyridine-3-carboxamide (PubChem CID 163519753) has the molecular formula C20H22F2N4O and a molecular weight of 372.42 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-1-[(2E,4Z)-1-iminohexa-2,4-dien-3-yl]imidazo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-1-[(2E,4Z)-1-iminohexa-2,4-dien-3-yl]imidazo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163519753 |
| Molecular Formula | C20H22F2N4O |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-1-[(2E,4Z)-1-iminohexa-2,4-dien-3-yl]imidazo[1,5-a]pyridine-3-carboxamide |
| SMILES | [H]/N=C/C=C(\C=C/C)c1nc(C(=O)NC2CCC(F)(F)CC2)n2ccccc12 |
| InChI | InChI=1S/C20H22F2N4O/c1-2-5-14(9-12-23)17-16-6-3-4-13-26(16)18(25-17)19(27)24-15-7-10-20(21,22)11-8-15/h2-6,9,12-13,15,23H,7-8,10-11H2,1H3,(H,24,27)/b5-2-,14-9+,23-12+ |
| InChIKey | DJUHYFRTHCHTGG-NALWHJFBSA-N |
| XLogP | 4.25 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|