C21H24N4O4 — CID 163520406
N-[(3S)-2,3-dihydroxypent-4-ynyl]-N-[2-(propan-2-ylamino)pyrimidin-4-yl]-2,3-dihydro-1-benzofuran-5-carboxamide (PubChem CID 163520406) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-[(3S)-2,3-dihydroxypent-4-ynyl]-N-[2-(propan-2-ylamino)pyrimidin-4-yl]-2,3-dihydro-1-benzofuran-5-carboxamide.
| Compound Name | N-[(3S)-2,3-dihydroxypent-4-ynyl]-N-[2-(propan-2-ylamino)pyrimidin-4-yl]-2,3-dihydro-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 163520406 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-[(3S)-2,3-dihydroxypent-4-ynyl]-N-[2-(propan-2-ylamino)pyrimidin-4-yl]-2,3-dihydro-1-benzofuran-5-carboxamide |
| SMILES | C#C[C@H](O)C(O)CN(C(=O)c1ccc2c(c1)CCO2)c1ccnc(NC(C)C)n1 |
| InChI | InChI=1S/C21H24N4O4/c1-4-16(26)17(27)12-25(19-7-9-22-21(24-19)23-13(2)3)20(28)15-5-6-18-14(11-15)8-10-29-18/h1,5-7,9,11,13,16-17,26-27H,8,10,12H2,2-3H3,(H,22,23,24)/t16-,17?/m0/s1 |
| InChIKey | DKICLMZGGIPXCQ-BHWOMJMDSA-N |
| XLogP | 1.23 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|