C26H30N4O2 — CID 58702656
N-(4-phenylbutyl)-N-[2-(propan-2-ylamino)pyrimidin-4-yl]-2,3-dihydro-1-benzofuran-5-carboxamide (PubChem CID 58702656) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-(4-phenylbutyl)-N-[2-(propan-2-ylamino)pyrimidin-4-yl]-2,3-dihydro-1-benzofuran-5-carboxamide.
| Compound Name | N-(4-phenylbutyl)-N-[2-(propan-2-ylamino)pyrimidin-4-yl]-2,3-dihydro-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 58702656 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N-(4-phenylbutyl)-N-[2-(propan-2-ylamino)pyrimidin-4-yl]-2,3-dihydro-1-benzofuran-5-carboxamide |
| SMILES | CC(C)Nc1nccc(N(CCCCc2ccccc2)C(=O)c2ccc3c(c2)CCO3)n1 |
| InChI | InChI=1S/C26H30N4O2/c1-19(2)28-26-27-15-13-24(29-26)30(16-7-6-10-20-8-4-3-5-9-20)25(31)22-11-12-23-21(18-22)14-17-32-23/h3-5,8-9,11-13,15,18-19H,6-7,10,14,16-17H2,1-2H3,(H,27,28,29) |
| InChIKey | IVIIAJVBWZETDY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|