C21H29N5O2 — CID 58702581
N-(5-aminopentyl)-N-[2-(propan-2-ylamino)pyrimidin-4-yl]-2,3-dihydro-1-benzofuran-5-carboxamide (PubChem CID 58702581) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is N-(5-aminopentyl)-N-[2-(propan-2-ylamino)pyrimidin-4-yl]-2,3-dihydro-1-benzofuran-5-carboxamide.
| Compound Name | N-(5-aminopentyl)-N-[2-(propan-2-ylamino)pyrimidin-4-yl]-2,3-dihydro-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 58702581 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | N-(5-aminopentyl)-N-[2-(propan-2-ylamino)pyrimidin-4-yl]-2,3-dihydro-1-benzofuran-5-carboxamide |
| SMILES | CC(C)Nc1nccc(N(CCCCCN)C(=O)c2ccc3c(c2)CCO3)n1 |
| InChI | InChI=1S/C21H29N5O2/c1-15(2)24-21-23-11-8-19(25-21)26(12-5-3-4-10-22)20(27)17-6-7-18-16(14-17)9-13-28-18/h6-8,11,14-15H,3-5,9-10,12-13,22H2,1-2H3,(H,23,24,25) |
| InChIKey | LXWJJRHLBIIYLZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|