C20H26ClN4O2+ — CID 163523529
[2-[[1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]piperidin-4-yl]amino]-2-oxoethyl]-methyloxidanium (PubChem CID 163523529) has the molecular formula C20H26ClN4O2+ and a molecular weight of 389.91 g/mol. Its IUPAC name is [2-[[1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]piperidin-4-yl]amino]-2-oxoethyl]-methyloxidanium.
| Compound Name | [2-[[1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]piperidin-4-yl]amino]-2-oxoethyl]-methyloxidanium |
|---|---|
| PubChem CID | 163523529 |
| Molecular Formula | C20H26ClN4O2+ |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [2-[[1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]piperidin-4-yl]amino]-2-oxoethyl]-methyloxidanium |
| SMILES | C[OH+]CC(=O)NC1CCN(c2cc(-c3ncc(C)cc3C)c(Cl)cn2)CC1 |
| InChI | InChI=1S/C20H25ClN4O2/c1-13-8-14(2)20(23-10-13)16-9-18(22-11-17(16)21)25-6-4-15(5-7-25)24-19(26)12-27-3/h8-11,15H,4-7,12H2,1-3H3,(H,24,26)/p+1 |
| InChIKey | DMVPZMMEBRRFJX-UHFFFAOYSA-O |
| XLogP | 2.66 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|