C17H35NO4 — CID 163524950
2-[5-(1-amino-3-ethylpentan-3-yl)oxy-2-ethyl-2-methylpentoxy]acetic acid (PubChem CID 163524950) has the molecular formula C17H35NO4 and a molecular weight of 317.47 g/mol. Its IUPAC name is 2-[5-(1-amino-3-ethylpentan-3-yl)oxy-2-ethyl-2-methylpentoxy]acetic acid.
| Compound Name | 2-[5-(1-amino-3-ethylpentan-3-yl)oxy-2-ethyl-2-methylpentoxy]acetic acid |
|---|---|
| PubChem CID | 163524950 |
| Molecular Formula | C17H35NO4 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | 2-[5-(1-amino-3-ethylpentan-3-yl)oxy-2-ethyl-2-methylpentoxy]acetic acid |
| SMILES | CCC(C)(CCCOC(CC)(CC)CCN)COCC(=O)O |
| InChI | InChI=1S/C17H35NO4/c1-5-16(4,14-21-13-15(19)20)9-8-12-22-17(6-2,7-3)10-11-18/h5-14,18H2,1-4H3,(H,19,20) |
| InChIKey | DNYNUNPJCBUGFV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|