About 2-[3-(carboxymethoxy)-2-(carboxymethoxymethyl)-2-methylpropoxy]acetic acid;molecular hydrogen
2-[3-(carboxymethoxy)-2-(carboxymethoxymethyl)-2-methylpropoxy]acetic acid;molecular hydrogen (PubChem CID 157307549) has the molecular formula C11H20O9
and a molecular weight of 296.27 g/mol. Its IUPAC name is 2-[3-(carboxymethoxy)-2-(carboxymethoxymethyl)-2-methylpropoxy]acetic acid;molecular hydrogen.
Molecular Properties
| Compound Name | 2-[3-(carboxymethoxy)-2-(carboxymethoxymethyl)-2-methylpropoxy]acetic acid;molecular hydrogen |
| PubChem CID | 157307549 |
| Molecular Formula | C11H20O9 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-[3-(carboxymethoxy)-2-(carboxymethoxymethyl)-2-methylpropoxy]acetic acid;molecular hydrogen |
| SMILES | CC(COCC(=O)O)(COCC(=O)O)COCC(=O)O.[H][H] |
| InChI | InChI=1S/C11H18O9.H2/c1-11(5-18-2-8(12)13,6-19-3-9(14)15)7-20-4-10(16)17;/h2-7H2,1H3,(H,12,13)(H,14,15)(H,16,17);1H |
| InChIKey | BCQVZFWPVMJPAN-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3-(carboxymethoxy)-2-(carboxymethoxymethyl)-2-methylpropoxy]acetic acid;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(carboxymethoxy)-2-(carboxymethoxymethyl)-2-methylpropoxy]acetic acid;molecular hydrogen?
The IUPAC name of 2-[3-(carboxymethoxy)-2-(carboxymethoxymethyl)-2-methylpropoxy]acetic acid;molecular hydrogen (CID 157307549) is 2-[3-(carboxymethoxy)-2-(carboxymethoxymethyl)-2-methylpropoxy]acetic acid;molecular hydrogen.
What is the SMILES notation for 2-[3-(carboxymethoxy)-2-(carboxymethoxymethyl)-2-methylpropoxy]acetic acid;molecular hydrogen?
The canonical SMILES for 2-[3-(carboxymethoxy)-2-(carboxymethoxymethyl)-2-methylpropoxy]acetic acid;molecular hydrogen is CC(COCC(=O)O)(COCC(=O)O)COCC(=O)O.[H][H].
What is the InChIKey of 2-[3-(carboxymethoxy)-2-(carboxymethoxymethyl)-2-methylpropoxy]acetic acid;molecular hydrogen?
The InChIKey is BCQVZFWPVMJPAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O9.H2/c1-11(5-18-2-8(12)13,6-19-3-9(14)15)7-20-4-10(16)17;/h2-7H2,1H3,(H,12,13)(H,14,15)(H,16,17);1H.
What are the key properties of 2-[3-(carboxymethoxy)-2-(carboxymethoxymethyl)-2-methylpropoxy]acetic acid;molecular hydrogen?
2-[3-(carboxymethoxy)-2-(carboxymethoxymethyl)-2-methylpropoxy]acetic acid;molecular hydrogen has a molecular weight of 296.27 g/mol, XLogP of -0.46, 12 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(carboxymethoxy)-2-(carboxymethoxymethyl)-2-methylpropoxy]acetic acid;molecular hydrogen is sourced from PubChem (CID 157307549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).