C11H18N2O — CID 163525167
(4S)-5-methyl-4-morpholin-4-ylcyclohexa-1,5-dien-1-amine (PubChem CID 163525167) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (4S)-5-methyl-4-morpholin-4-ylcyclohexa-1,5-dien-1-amine.
| Compound Name | (4S)-5-methyl-4-morpholin-4-ylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 163525167 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (4S)-5-methyl-4-morpholin-4-ylcyclohexa-1,5-dien-1-amine |
| SMILES | CC1=CC(N)=CC[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C11H18N2O/c1-9-8-10(12)2-3-11(9)13-4-6-14-7-5-13/h2,8,11H,3-7,12H2,1H3/t11-/m0/s1 |
| InChIKey | DOCWFNFBVKLXPD-NSHDSACASA-N |
| XLogP | 0.88 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |