C8H9Br — CID 163529142
3-(bromomethyl)bicyclo[4.1.0]hepta-2,4-diene (PubChem CID 163529142) has the molecular formula C8H9Br and a molecular weight of 185.06 g/mol. Its IUPAC name is 3-(bromomethyl)bicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | 3-(bromomethyl)bicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 163529142 |
| Molecular Formula | C8H9Br |
| Molecular Weight | 185.06 g/mol |
| Exact Mass | 183.99 |
| IUPAC Name | 3-(bromomethyl)bicyclo[4.1.0]hepta-2,4-diene |
| SMILES | BrCC1=CC2CC2C=C1 |
| InChI | InChI=1S/C8H9Br/c9-5-6-1-2-7-4-8(7)3-6/h1-3,7-8H,4-5H2 |
| InChIKey | DRKIBAPSPMBSGJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.06 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|