C12H11Br — CID 90084679
3-bromospiro[bicyclo[4.1.0]hepta-1,5-diene-7,5'-cyclohexa-1,3-diene] (PubChem CID 90084679) has the molecular formula C12H11Br and a molecular weight of 235.12 g/mol. Its IUPAC name is 3-bromospiro[bicyclo[4.1.0]hepta-1,5-diene-7,5'-cyclohexa-1,3-diene].
| Compound Name | 3-bromospiro[bicyclo[4.1.0]hepta-1,5-diene-7,5'-cyclohexa-1,3-diene] |
|---|---|
| PubChem CID | 90084679 |
| Molecular Formula | C12H11Br |
| Molecular Weight | 235.12 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 3-bromospiro[bicyclo[4.1.0]hepta-1,5-diene-7,5'-cyclohexa-1,3-diene] |
| SMILES | BrC1C=C2C(=CC1)C21C=CC=CC1 |
| InChI | InChI=1S/C12H11Br/c13-9-4-5-10-11(8-9)12(10)6-2-1-3-7-12/h1-3,5-6,8-9H,4,7H2 |
| InChIKey | WDLLJQSOEONTPQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.12 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|