C29H35FI2N5O2S- — CID 163530162
CID 163530162 (PubChem CID 163530162) has the molecular formula C29H35FI2N5O2S- and a molecular weight of 790.50 g/mol.
| Compound Name | CID 163530162 |
|---|---|
| PubChem CID | 163530162 |
| Molecular Formula | C29H35FI2N5O2S- |
| Molecular Weight | 790.50 g/mol |
| Exact Mass | 790.06 |
| IUPAC Name | — |
| SMILES | C=Ic1ccc(-c2nc(Nc3ccc(C[C@H]4CCCCN(C)C[I-]4)cc3)ncc2F)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C29H35FI2N5O2S/c1-31-22-10-13-25(27(18-22)40(38,39)37-15-5-6-16-37)28-26(30)19-33-29(35-28)34-24-11-8-21(9-12-24)17-23-7-3-4-14-36(2)20-32-23/h8-13,18-19,23H,1,3-7,14-17,20H2,2H3,(H,33,34,35)/q-1/t23-/m1/s1 |
| InChIKey | JVHACIWAJAFEKJ-HSZRJFAPSA-N |
| XLogP | 2.46 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|