C17H23N3OS — CID 163530608
methyl N-[3-cyano-5-(cyclohexylmethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]methanimidate (PubChem CID 163530608) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is methyl N-[3-cyano-5-(cyclohexylmethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]methanimidate.
| Compound Name | methyl N-[3-cyano-5-(cyclohexylmethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]methanimidate |
|---|---|
| PubChem CID | 163530608 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | methyl N-[3-cyano-5-(cyclohexylmethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]methanimidate |
| SMILES | COC=Nc1sc2c(c1C#N)CN(CC1CCCCC1)CC2 |
| InChI | InChI=1S/C17H23N3OS/c1-21-12-19-17-14(9-18)15-11-20(8-7-16(15)22-17)10-13-5-3-2-4-6-13/h12-13H,2-8,10-11H2,1H3 |
| InChIKey | DSQUUBYLOJMIHQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 48.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|