C21H33N3O — CID 153377648
methyl N-[(Z)-1-cyano-1-[1-(cyclohexylmethyl)-4-methyl-3,6-dihydro-2H-pyridin-5-yl]pent-1-en-2-yl]methanimidate (PubChem CID 153377648) has the molecular formula C21H33N3O and a molecular weight of 343.52 g/mol. Its IUPAC name is methyl N-[(Z)-1-cyano-1-[1-(cyclohexylmethyl)-4-methyl-3,6-dihydro-2H-pyridin-5-yl]pent-1-en-2-yl]methanimidate.
| Compound Name | methyl N-[(Z)-1-cyano-1-[1-(cyclohexylmethyl)-4-methyl-3,6-dihydro-2H-pyridin-5-yl]pent-1-en-2-yl]methanimidate |
|---|---|
| PubChem CID | 153377648 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | methyl N-[(Z)-1-cyano-1-[1-(cyclohexylmethyl)-4-methyl-3,6-dihydro-2H-pyridin-5-yl]pent-1-en-2-yl]methanimidate |
| SMILES | CCCC(/N=C/OC)=C(/C#N)C1=C(C)CCN(CC2CCCCC2)C1 |
| InChI | InChI=1S/C21H33N3O/c1-4-8-21(23-16-25-3)19(13-22)20-15-24(12-11-17(20)2)14-18-9-6-5-7-10-18/h16,18H,4-12,14-15H2,1-3H3/b21-19+,23-16+ |
| InChIKey | IBERSVGLGNAEPT-SVSODDHBSA-N |
| XLogP | 4.84 |
| TPSA | 48.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|