C16H25N3 — CID 167297736
(Z)-2-[1-(cyclohexylmethyl)-3,6-dihydro-2H-pyridin-5-yl]-3-(methylamino)prop-2-enenitrile (PubChem CID 167297736) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is (Z)-2-[1-(cyclohexylmethyl)-3,6-dihydro-2H-pyridin-5-yl]-3-(methylamino)prop-2-enenitrile.
| Compound Name | (Z)-2-[1-(cyclohexylmethyl)-3,6-dihydro-2H-pyridin-5-yl]-3-(methylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 167297736 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | (Z)-2-[1-(cyclohexylmethyl)-3,6-dihydro-2H-pyridin-5-yl]-3-(methylamino)prop-2-enenitrile |
| SMILES | CN/C=C(\C#N)C1=CCCN(CC2CCCCC2)C1 |
| InChI | InChI=1S/C16H25N3/c1-18-11-16(10-17)15-8-5-9-19(13-15)12-14-6-3-2-4-7-14/h8,11,14,18H,2-7,9,12-13H2,1H3/b16-11+ |
| InChIKey | XKHCKPPGBLNHJE-LFIBNONCSA-N |
| XLogP | 2.83 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|