C29H29N2O6- — CID 163531129
3,5-dimethyl-4-[2-[(5-oxido-4-oxa-5-azatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethoxy]-N,N-diphenylbenzeneamine oxide (PubChem CID 163531129) has the molecular formula C29H29N2O6- and a molecular weight of 501.56 g/mol. Its IUPAC name is 3,5-dimethyl-4-[2-[(5-oxido-4-oxa-5-azatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethoxy]-N,N-diphenylbenzeneamine oxide.
| Compound Name | 3,5-dimethyl-4-[2-[(5-oxido-4-oxa-5-azatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethoxy]-N,N-diphenylbenzeneamine oxide |
|---|---|
| PubChem CID | 163531129 |
| Molecular Formula | C29H29N2O6- |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 3,5-dimethyl-4-[2-[(5-oxido-4-oxa-5-azatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethoxy]-N,N-diphenylbenzeneamine oxide |
| SMILES | Cc1cc([N+]([O-])(c2ccccc2)c2ccccc2)cc(C)c1OCC(=O)OC1C2CC3C1ON([O-])C3C2 |
| InChI | InChI=1S/C29H29N2O6/c1-18-13-23(31(34,21-9-5-3-6-10-21)22-11-7-4-8-12-22)14-19(2)27(18)35-17-26(32)36-28-20-15-24-25(16-20)30(33)37-29(24)28/h3-14,20,24-25,28-29H,15-17H2,1-2H3/q-1 |
| InChIKey | NHACWSNATDRGEE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|