C32H30FNO3 — CID 163531869
4-[3-(3-fluoro-4-methylphenyl)-3-(4-methoxy-3-methylphenyl)benzo[f]chromen-6-yl]morpholine (PubChem CID 163531869) has the molecular formula C32H30FNO3 and a molecular weight of 495.59 g/mol. Its IUPAC name is 4-[3-(3-fluoro-4-methylphenyl)-3-(4-methoxy-3-methylphenyl)benzo[f]chromen-6-yl]morpholine.
| Compound Name | 4-[3-(3-fluoro-4-methylphenyl)-3-(4-methoxy-3-methylphenyl)benzo[f]chromen-6-yl]morpholine |
|---|---|
| PubChem CID | 163531869 |
| Molecular Formula | C32H30FNO3 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 4-[3-(3-fluoro-4-methylphenyl)-3-(4-methoxy-3-methylphenyl)benzo[f]chromen-6-yl]morpholine |
| SMILES | COc1ccc(C2(c3ccc(C)c(F)c3)C=Cc3c(cc(N4CCOCC4)c4ccccc34)O2)cc1C |
| InChI | InChI=1S/C32H30FNO3/c1-21-8-9-24(19-28(21)33)32(23-10-11-30(35-3)22(2)18-23)13-12-27-25-6-4-5-7-26(25)29(20-31(27)37-32)34-14-16-36-17-15-34/h4-13,18-20H,14-17H2,1-3H3 |
| InChIKey | DTRCVQICZLAXQS-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|