C28H28F3NO3 — CID 139813735
4-[3-methyl-3-[4-propan-2-yloxy-2-(trifluoromethyl)phenyl]benzo[f]chromen-6-yl]morpholine (PubChem CID 139813735) has the molecular formula C28H28F3NO3 and a molecular weight of 483.53 g/mol. Its IUPAC name is 4-[3-methyl-3-[4-propan-2-yloxy-2-(trifluoromethyl)phenyl]benzo[f]chromen-6-yl]morpholine.
| Compound Name | 4-[3-methyl-3-[4-propan-2-yloxy-2-(trifluoromethyl)phenyl]benzo[f]chromen-6-yl]morpholine |
|---|---|
| PubChem CID | 139813735 |
| Molecular Formula | C28H28F3NO3 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 4-[3-methyl-3-[4-propan-2-yloxy-2-(trifluoromethyl)phenyl]benzo[f]chromen-6-yl]morpholine |
| SMILES | CC(C)Oc1ccc(C2(C)C=Cc3c(cc(N4CCOCC4)c4ccccc34)O2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H28F3NO3/c1-18(2)34-19-8-9-23(24(16-19)28(29,30)31)27(3)11-10-22-20-6-4-5-7-21(20)25(17-26(22)35-27)32-12-14-33-15-13-32/h4-11,16-18H,12-15H2,1-3H3 |
| InChIKey | RDDZNCLVMJNTSO-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|