C33H31FN2O3 — CID 21305843
4-[3-[(3R)-3-(2-fluorophenyl)-6-morpholin-4-ylbenzo[f]chromen-3-yl]phenyl]morpholine (PubChem CID 21305843) has the molecular formula C33H31FN2O3 and a molecular weight of 522.62 g/mol. Its IUPAC name is 4-[3-[(3R)-3-(2-fluorophenyl)-6-morpholin-4-ylbenzo[f]chromen-3-yl]phenyl]morpholine.
| Compound Name | 4-[3-[(3R)-3-(2-fluorophenyl)-6-morpholin-4-ylbenzo[f]chromen-3-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 21305843 |
| Molecular Formula | C33H31FN2O3 |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 4-[3-[(3R)-3-(2-fluorophenyl)-6-morpholin-4-ylbenzo[f]chromen-3-yl]phenyl]morpholine |
| SMILES | Fc1ccccc1[C@]1(c2cccc(N3CCOCC3)c2)C=Cc2c(cc(N3CCOCC3)c3ccccc23)O1 |
| InChI | InChI=1S/C33H31FN2O3/c34-30-11-4-3-10-29(30)33(24-6-5-7-25(22-24)35-14-18-37-19-15-35)13-12-28-26-8-1-2-9-27(26)31(23-32(28)39-33)36-16-20-38-21-17-36/h1-13,22-23H,14-21H2/t33-/m1/s1 |
| InChIKey | ONJLZDBDSFGKQT-MGBGTMOVSA-N |
| XLogP | 6.00 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|