C20H15N7OS — CID 163532259
N-[2-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-ylamino)pyrimidin-5-yl]cyclohexa-1,3-diene-1-carboxamide (PubChem CID 163532259) has the molecular formula C20H15N7OS and a molecular weight of 401.46 g/mol. Its IUPAC name is N-[2-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-ylamino)pyrimidin-5-yl]cyclohexa-1,3-diene-1-carboxamide.
| Compound Name | N-[2-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-ylamino)pyrimidin-5-yl]cyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 163532259 |
| Molecular Formula | C20H15N7OS |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-[2-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-ylamino)pyrimidin-5-yl]cyclohexa-1,3-diene-1-carboxamide |
| SMILES | O=C(Nc1cnc(Nc2ncnc3c2sc2ncccc23)nc1)C1=CC=CCC1 |
| InChI | InChI=1S/C20H15N7OS/c28-18(12-5-2-1-3-6-12)26-13-9-22-20(23-10-13)27-17-16-15(24-11-25-17)14-7-4-8-21-19(14)29-16/h1-2,4-5,7-11H,3,6H2,(H,26,28)(H,22,23,24,25,27) |
| InChIKey | DTYXHQISKMDVCA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |