C14H16F3NO5 — CID 163532554
ethyl 2-amino-4-(1,3-dioxolan-2-yl)-3-methyl-5-(trifluoromethoxy)benzoate (PubChem CID 163532554) has the molecular formula C14H16F3NO5 and a molecular weight of 335.28 g/mol. Its IUPAC name is ethyl 2-amino-4-(1,3-dioxolan-2-yl)-3-methyl-5-(trifluoromethoxy)benzoate.
| Compound Name | ethyl 2-amino-4-(1,3-dioxolan-2-yl)-3-methyl-5-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 163532554 |
| Molecular Formula | C14H16F3NO5 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | ethyl 2-amino-4-(1,3-dioxolan-2-yl)-3-methyl-5-(trifluoromethoxy)benzoate |
| SMILES | CCOC(=O)c1cc(OC(F)(F)F)c(C2OCCO2)c(C)c1N |
| InChI | InChI=1S/C14H16F3NO5/c1-3-20-12(19)8-6-9(23-14(15,16)17)10(7(2)11(8)18)13-21-4-5-22-13/h6,13H,3-5,18H2,1-2H3 |
| InChIKey | DUFPYJDMDDOWOA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|