C13H20F4O2S — CID 163532599
3,3,4,4-tetrafluoropentyl 3-(thian-4-yl)propanoate (PubChem CID 163532599) has the molecular formula C13H20F4O2S and a molecular weight of 316.36 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoropentyl 3-(thian-4-yl)propanoate.
| Compound Name | 3,3,4,4-tetrafluoropentyl 3-(thian-4-yl)propanoate |
|---|---|
| PubChem CID | 163532599 |
| Molecular Formula | C13H20F4O2S |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 3,3,4,4-tetrafluoropentyl 3-(thian-4-yl)propanoate |
| SMILES | CC(F)(F)C(F)(F)CCOC(=O)CCC1CCSCC1 |
| InChI | InChI=1S/C13H20F4O2S/c1-12(14,15)13(16,17)6-7-19-11(18)3-2-10-4-8-20-9-5-10/h10H,2-9H2,1H3 |
| InChIKey | KKXGUCKTKFGPSM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|