C27H36N5O5+ — CID 163534878
1-aminoethylidene-[4-[[4-(3-carboxypropanoyl)piperazin-1-yl]methyl]phenyl]-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)azanium (PubChem CID 163534878) has the molecular formula C27H36N5O5+ and a molecular weight of 510.62 g/mol. Its IUPAC name is 1-aminoethylidene-[4-[[4-(3-carboxypropanoyl)piperazin-1-yl]methyl]phenyl]-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)azanium.
| Compound Name | 1-aminoethylidene-[4-[[4-(3-carboxypropanoyl)piperazin-1-yl]methyl]phenyl]-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)azanium |
|---|---|
| PubChem CID | 163534878 |
| Molecular Formula | C27H36N5O5+ |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 1-aminoethylidene-[4-[[4-(3-carboxypropanoyl)piperazin-1-yl]methyl]phenyl]-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)azanium |
| SMILES | [H]/N=C(c1cc(C(C)C)c(O)cc1O)/[N+](=C(\C)N)c1ccc(CN2CCN(C(=O)CCC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C27H35N5O5/c1-17(2)21-14-22(24(34)15-23(21)33)27(29)32(18(3)28)20-6-4-19(5-7-20)16-30-10-12-31(13-11-30)25(35)8-9-26(36)37/h4-7,14-15,17,28H,8-13,16H2,1-3H3,(H4,29,33,34,36,37)/p+1 |
| InChIKey | XGCUISKATZCKCH-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 154.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|