C32H46N6O8 — CID 177202135
N-[2-[2-[2-[3-[4-[[4-[carbamoyl-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)amino]phenyl]methyl]piperazin-1-yl]-3-oxopropoxy]ethoxy]ethoxy]ethyl]formamide (PubChem CID 177202135) has the molecular formula C32H46N6O8 and a molecular weight of 642.75 g/mol. Its IUPAC name is N-[2-[2-[2-[3-[4-[[4-[carbamoyl-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)amino]phenyl]methyl]piperazin-1-yl]-3-oxopropoxy]ethoxy]ethoxy]ethyl]formamide.
| Compound Name | N-[2-[2-[2-[3-[4-[[4-[carbamoyl-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)amino]phenyl]methyl]piperazin-1-yl]-3-oxopropoxy]ethoxy]ethoxy]ethyl]formamide |
|---|---|
| PubChem CID | 177202135 |
| Molecular Formula | C32H46N6O8 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.34 |
| IUPAC Name | N-[2-[2-[2-[3-[4-[[4-[carbamoyl-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)amino]phenyl]methyl]piperazin-1-yl]-3-oxopropoxy]ethoxy]ethoxy]ethyl]formamide |
| SMILES | [H]/N=C(\c1cc(C(C)C)c(O)cc1O)N(C(N)=O)c1ccc(CN2CCN(C(=O)CCOCCOCCOCCNC=O)CC2)cc1 |
| InChI | InChI=1S/C32H46N6O8/c1-23(2)26-19-27(29(41)20-28(26)40)31(33)38(32(34)43)25-5-3-24(4-6-25)21-36-9-11-37(12-10-36)30(42)7-13-44-15-17-46-18-16-45-14-8-35-22-39/h3-6,19-20,22-23,33,40-41H,7-18,21H2,1-2H3,(H2,34,43)(H,35,39)/b33-31+ |
| InChIKey | PAJXAMBSYLFHIY-QOSDPKFLSA-N |
| XLogP | 1.96 |
| TPSA | 190.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|