C25H34N6O3 — CID 143939850
2-[4-(4-ethylpiperazin-1-yl)-N-(2-hydroxy-4-methoxy-5-propan-2-ylbenzenecarboximidoyl)anilino]-2-iminoacetamide (PubChem CID 143939850) has the molecular formula C25H34N6O3 and a molecular weight of 466.59 g/mol. Its IUPAC name is 2-[4-(4-ethylpiperazin-1-yl)-N-(2-hydroxy-4-methoxy-5-propan-2-ylbenzenecarboximidoyl)anilino]-2-iminoacetamide.
| Compound Name | 2-[4-(4-ethylpiperazin-1-yl)-N-(2-hydroxy-4-methoxy-5-propan-2-ylbenzenecarboximidoyl)anilino]-2-iminoacetamide |
|---|---|
| PubChem CID | 143939850 |
| Molecular Formula | C25H34N6O3 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 2-[4-(4-ethylpiperazin-1-yl)-N-(2-hydroxy-4-methoxy-5-propan-2-ylbenzenecarboximidoyl)anilino]-2-iminoacetamide |
| SMILES | [H]/N=C(\C(N)=O)N(/C(=N/[H])c1cc(C(C)C)c(OC)cc1O)c1ccc(N2CCN(CC)CC2)cc1 |
| InChI | InChI=1S/C25H34N6O3/c1-5-29-10-12-30(13-11-29)17-6-8-18(9-7-17)31(24(27)25(28)33)23(26)20-14-19(16(2)3)22(34-4)15-21(20)32/h6-9,14-16,26-27,32H,5,10-13H2,1-4H3,(H2,28,33)/b26-23+,27-24+ |
| InChIKey | ZHMWKMKPBRZDRA-LSBUKLHESA-N |
| XLogP | 2.96 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|