C22H28N4O5 — CID 142606011
4-[(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-(2-oxoethanimidoyl)amino]benzoic acid;N-methylethanamine (PubChem CID 142606011) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is 4-[(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-(2-oxoethanimidoyl)amino]benzoic acid;N-methylethanamine.
| Compound Name | 4-[(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-(2-oxoethanimidoyl)amino]benzoic acid;N-methylethanamine |
|---|---|
| PubChem CID | 142606011 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 4-[(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-(2-oxoethanimidoyl)amino]benzoic acid;N-methylethanamine |
| SMILES | CCNC.[H]/N=C(\C=O)N(/C(=N/[H])c1cc(C(C)C)c(O)cc1O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H19N3O5.C3H9N/c1-10(2)13-7-14(16(25)8-15(13)24)18(21)22(17(20)9-23)12-5-3-11(4-6-12)19(26)27;1-3-4-2/h3-10,20-21,24-25H,1-2H3,(H,26,27);4H,3H2,1-2H3/b20-17+,21-18+; |
| InChIKey | QXMSDSMRIQGBNV-BQAWZSDCSA-N |
| XLogP | 3.15 |
| TPSA | 157.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|