C29H40N6O7 — CID 123647570
[1-[4-[[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-(2-amino-2-oxoethanimidoyl)amino]benzoyl]piperidin-4-yl]methyl N-(3-hydroxypropyl)carbamate (PubChem CID 123647570) has the molecular formula C29H40N6O7 and a molecular weight of 584.67 g/mol. Its IUPAC name is [1-[4-[[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-(2-amino-2-oxoethanimidoyl)amino]benzoyl]piperidin-4-yl]methyl N-(3-hydroxypropyl)carbamate.
| Compound Name | [1-[4-[[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-(2-amino-2-oxoethanimidoyl)amino]benzoyl]piperidin-4-yl]methyl N-(3-hydroxypropyl)carbamate |
|---|---|
| PubChem CID | 123647570 |
| Molecular Formula | C29H40N6O7 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | [1-[4-[[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-(2-amino-2-oxoethanimidoyl)amino]benzoyl]piperidin-4-yl]methyl N-(3-hydroxypropyl)carbamate |
| SMILES | [H]/N=C(\C(N)=O)N(c1ccc(C(=O)N2CCC(COC(=O)NCCCO)CC2)cc1)C(N)c1cc(C(C)C)c(O)cc1O |
| InChI | InChI=1S/C29H40N6O7/c1-17(2)21-14-22(24(38)15-23(21)37)25(30)35(26(31)27(32)39)20-6-4-19(5-7-20)28(40)34-11-8-18(9-12-34)16-42-29(41)33-10-3-13-36/h4-7,14-15,17-18,25,31,36-38H,3,8-13,16,30H2,1-2H3,(H2,32,39)(H,33,41)/b31-26+ |
| InChIKey | KDYCJQQXFFPCRZ-GKPLWNPISA-N |
| XLogP | 2.11 |
| TPSA | 215.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|