C27H39FN6O3 — CID 90933019
2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]anilino]-2-imino-N-propan-2-ylacetamide (PubChem CID 90933019) has the molecular formula C27H39FN6O3 and a molecular weight of 514.65 g/mol. Its IUPAC name is 2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]anilino]-2-imino-N-propan-2-ylacetamide.
| Compound Name | 2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]anilino]-2-imino-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 90933019 |
| Molecular Formula | C27H39FN6O3 |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]anilino]-2-imino-N-propan-2-ylacetamide |
| SMILES | [H]/N=C(\C(=O)NC(C)C)N(c1ccc(CN2CCN(C)CC2)c(F)c1)C(N)c1cc(C(C)C)c(O)cc1O |
| InChI | InChI=1S/C27H39FN6O3/c1-16(2)20-13-21(24(36)14-23(20)35)25(29)34(26(30)27(37)31-17(3)4)19-7-6-18(22(28)12-19)15-33-10-8-32(5)9-11-33/h6-7,12-14,16-17,25,30,35-36H,8-11,15,29H2,1-5H3,(H,31,37)/b30-26+ |
| InChIKey | FMACSXXTWGPTFY-URGPHPNLSA-N |
| XLogP | 3.07 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|