C27H34F3N5O5 — CID 143939895
1-[[4-[[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-[2-oxo-2-(2,2,2-trifluoroethylamino)ethanimidoyl]amino]phenyl]methyl]piperidine-4-carboxylic acid (PubChem CID 143939895) has the molecular formula C27H34F3N5O5 and a molecular weight of 565.59 g/mol. Its IUPAC name is 1-[[4-[[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-[2-oxo-2-(2,2,2-trifluoroethylamino)ethanimidoyl]amino]phenyl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[[4-[[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-[2-oxo-2-(2,2,2-trifluoroethylamino)ethanimidoyl]amino]phenyl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 143939895 |
| Molecular Formula | C27H34F3N5O5 |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | 1-[[4-[[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-[2-oxo-2-(2,2,2-trifluoroethylamino)ethanimidoyl]amino]phenyl]methyl]piperidine-4-carboxylic acid |
| SMILES | [H]/N=C(\C(=O)NCC(F)(F)F)N(c1ccc(CN2CCC(C(=O)O)CC2)cc1)C(N)c1cc(C(C)C)c(O)cc1O |
| InChI | InChI=1S/C27H34F3N5O5/c1-15(2)19-11-20(22(37)12-21(19)36)23(31)35(24(32)25(38)33-14-27(28,29)30)18-5-3-16(4-6-18)13-34-9-7-17(8-10-34)26(39)40/h3-6,11-12,15,17,23,32,36-37H,7-10,13-14,31H2,1-2H3,(H,33,38)(H,39,40)/b32-24+ |
| InChIKey | SYIQOWJNQSRPAB-FEZSWGLMSA-N |
| XLogP | 3.64 |
| TPSA | 163.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|