C26H36FN5O4 — CID 90898707
2-[N-[amino-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)methyl]-2-fluoro-4-(morpholin-4-ylmethyl)anilino]-N-ethyl-2-iminoacetamide (PubChem CID 90898707) has the molecular formula C26H36FN5O4 and a molecular weight of 501.60 g/mol. Its IUPAC name is 2-[N-[amino-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)methyl]-2-fluoro-4-(morpholin-4-ylmethyl)anilino]-N-ethyl-2-iminoacetamide.
| Compound Name | 2-[N-[amino-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)methyl]-2-fluoro-4-(morpholin-4-ylmethyl)anilino]-N-ethyl-2-iminoacetamide |
|---|---|
| PubChem CID | 90898707 |
| Molecular Formula | C26H36FN5O4 |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | 2-[N-[amino-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)methyl]-2-fluoro-4-(morpholin-4-ylmethyl)anilino]-N-ethyl-2-iminoacetamide |
| SMILES | [H]/N=C(\C(=O)NCC)N(c1ccc(CN2CCOCC2)cc1F)C(N)c1cc(C(C)C)c(OC)cc1O |
| InChI | InChI=1S/C26H36FN5O4/c1-5-30-26(34)25(29)32(24(28)19-13-18(16(2)3)23(35-4)14-22(19)33)21-7-6-17(12-20(21)27)15-31-8-10-36-11-9-31/h6-7,12-14,16,24,29,33H,5,8-11,15,28H2,1-4H3,(H,30,34)/b29-25+ |
| InChIKey | DOCCFXJEAMGDGJ-XLVZBRSZSA-N |
| XLogP | 3.07 |
| TPSA | 124.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|