C28H43FN6O3 — CID 90977547
2-amino-2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-4-[[ethyl-[2-(ethylamino)ethyl]amino]methyl]-3-fluoroanilino]-N-cyclopropylacetamide (PubChem CID 90977547) has the molecular formula C28H43FN6O3 and a molecular weight of 530.69 g/mol. Its IUPAC name is 2-amino-2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-4-[[ethyl-[2-(ethylamino)ethyl]amino]methyl]-3-fluoroanilino]-N-cyclopropylacetamide.
| Compound Name | 2-amino-2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-4-[[ethyl-[2-(ethylamino)ethyl]amino]methyl]-3-fluoroanilino]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 90977547 |
| Molecular Formula | C28H43FN6O3 |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | 2-amino-2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-4-[[ethyl-[2-(ethylamino)ethyl]amino]methyl]-3-fluoroanilino]-N-cyclopropylacetamide |
| SMILES | CCNCCN(CC)Cc1ccc(N(C(N)C(=O)NC2CC2)C(N)c2cc(C(C)C)c(O)cc2O)cc1F |
| InChI | InChI=1S/C28H43FN6O3/c1-5-32-11-12-34(6-2)16-18-7-10-20(13-23(18)29)35(27(31)28(38)33-19-8-9-19)26(30)22-14-21(17(3)4)24(36)15-25(22)37/h7,10,13-15,17,19,26-27,32,36-37H,5-6,8-9,11-12,16,30-31H2,1-4H3,(H,33,38) |
| InChIKey | UXFKLZCBLQDANE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|