C19H21N3O4 — CID 123731204
N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-N-(4-formylphenyl)-2-oxoethanimidamide (PubChem CID 123731204) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-N-(4-formylphenyl)-2-oxoethanimidamide.
| Compound Name | N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-N-(4-formylphenyl)-2-oxoethanimidamide |
|---|---|
| PubChem CID | 123731204 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-N-(4-formylphenyl)-2-oxoethanimidamide |
| SMILES | [H]/N=C(\C=O)N(c1ccc(C=O)cc1)C(N)c1cc(C(C)C)c(O)cc1O |
| InChI | InChI=1S/C19H21N3O4/c1-11(2)14-7-15(17(26)8-16(14)25)19(21)22(18(20)10-24)13-5-3-12(9-23)4-6-13/h3-11,19-20,25-26H,21H2,1-2H3/b20-18+ |
| InChIKey | HDTBUSVDURIQGG-CZIZESTLSA-N |
| XLogP | 2.67 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|