C25H31F3N6O3 — CID 136648956
2-[N-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-4-(4-methylpiperazin-1-yl)anilino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 136648956) has the molecular formula C25H31F3N6O3 and a molecular weight of 520.56 g/mol. Its IUPAC name is 2-[N-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-4-(4-methylpiperazin-1-yl)anilino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[N-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-4-(4-methylpiperazin-1-yl)anilino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 136648956 |
| Molecular Formula | C25H31F3N6O3 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 2-[N-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-4-(4-methylpiperazin-1-yl)anilino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | [H]/N=C(\C(=O)NCC(F)(F)F)N(/C(=N/[H])c1cc(C(C)C)c(O)cc1O)c1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C25H31F3N6O3/c1-15(2)18-12-19(21(36)13-20(18)35)22(29)34(23(30)24(37)31-14-25(26,27)28)17-6-4-16(5-7-17)33-10-8-32(3)9-11-33/h4-7,12-13,15,29-30,35-36H,8-11,14H2,1-3H3,(H,31,37)/b29-22+,30-23+ |
| InChIKey | ONPFSGCOEQDQNN-KBWMUOTDSA-N |
| XLogP | 3.46 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|