C25H36N6O3 — CID 155064571
N-amino-N-[4-[[4-(4-aminobutanoyl)piperazin-1-yl]methyl]phenyl]-2,4-dihydroxy-5-propan-2-ylbenzenecarboximidamide (PubChem CID 155064571) has the molecular formula C25H36N6O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-amino-N-[4-[[4-(4-aminobutanoyl)piperazin-1-yl]methyl]phenyl]-2,4-dihydroxy-5-propan-2-ylbenzenecarboximidamide.
| Compound Name | N-amino-N-[4-[[4-(4-aminobutanoyl)piperazin-1-yl]methyl]phenyl]-2,4-dihydroxy-5-propan-2-ylbenzenecarboximidamide |
|---|---|
| PubChem CID | 155064571 |
| Molecular Formula | C25H36N6O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | N-amino-N-[4-[[4-(4-aminobutanoyl)piperazin-1-yl]methyl]phenyl]-2,4-dihydroxy-5-propan-2-ylbenzenecarboximidamide |
| SMILES | [H]/N=C(/c1cc(C(C)C)c(O)cc1O)N(N)c1ccc(CN2CCN(C(=O)CCCN)CC2)cc1 |
| InChI | InChI=1S/C25H36N6O3/c1-17(2)20-14-21(23(33)15-22(20)32)25(27)31(28)19-7-5-18(6-8-19)16-29-10-12-30(13-11-29)24(34)4-3-9-26/h5-8,14-15,17,27,32-33H,3-4,9-13,16,26,28H2,1-2H3/b27-25- |
| InChIKey | JNFZWELCWCZLMX-RFBIWTDZSA-N |
| XLogP | 2.31 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|