C11H16F2N2 — CID 163535079
(1E,3E)-N-[(E)-2-(ethylideneamino)-1-fluoroethenyl]-1-fluoro-N,2-dimethylpenta-1,3-dien-1-amine (PubChem CID 163535079) has the molecular formula C11H16F2N2 and a molecular weight of 214.26 g/mol. Its IUPAC name is (1E,3E)-N-[(E)-2-(ethylideneamino)-1-fluoroethenyl]-1-fluoro-N,2-dimethylpenta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-N-[(E)-2-(ethylideneamino)-1-fluoroethenyl]-1-fluoro-N,2-dimethylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163535079 |
| Molecular Formula | C11H16F2N2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | (1E,3E)-N-[(E)-2-(ethylideneamino)-1-fluoroethenyl]-1-fluoro-N,2-dimethylpenta-1,3-dien-1-amine |
| SMILES | C/C=C/C(C)=C(/F)N(C)/C(F)=C\N=C\C |
| InChI | InChI=1S/C11H16F2N2/c1-5-7-9(3)11(13)15(4)10(12)8-14-6-2/h5-8H,1-4H3/b7-5+,10-8-,11-9-,14-6+ |
| InChIKey | DWFWZGKFECUQCI-VYCJNSJMSA-N |
| XLogP | 3.55 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|