C26H31N3O3 — CID 163539425
[7-(3,5-dimethyl-4,5-dihydro-1,2-oxazol-4-yl)-9-ethylcarbazol-3-yl]-[(2S,6R)-2,6-dimethylmorpholin-4-yl]methanone (PubChem CID 163539425) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is [7-(3,5-dimethyl-4,5-dihydro-1,2-oxazol-4-yl)-9-ethylcarbazol-3-yl]-[(2S,6R)-2,6-dimethylmorpholin-4-yl]methanone.
| Compound Name | [7-(3,5-dimethyl-4,5-dihydro-1,2-oxazol-4-yl)-9-ethylcarbazol-3-yl]-[(2S,6R)-2,6-dimethylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 163539425 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | [7-(3,5-dimethyl-4,5-dihydro-1,2-oxazol-4-yl)-9-ethylcarbazol-3-yl]-[(2S,6R)-2,6-dimethylmorpholin-4-yl]methanone |
| SMILES | CCn1c2ccc(C(=O)N3C[C@@H](C)O[C@@H](C)C3)cc2c2ccc(C3C(C)=NOC3C)cc21 |
| InChI | InChI=1S/C26H31N3O3/c1-6-29-23-10-8-20(26(30)28-13-15(2)31-16(3)14-28)11-22(23)21-9-7-19(12-24(21)29)25-17(4)27-32-18(25)5/h7-12,15-16,18,25H,6,13-14H2,1-5H3/t15-,16+,18?,25? |
| InChIKey | DZVLVSNDDUCKJD-GCRMNNPKSA-N |
| XLogP | 4.94 |
| TPSA | 56.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |