C29H31N5O — CID 163541334
cyclopropyl-[3-[6-[4-[(2S,6R)-2-ethenyl-6-methylpiperazin-1-yl]phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]phenyl]methanol (PubChem CID 163541334) has the molecular formula C29H31N5O and a molecular weight of 465.60 g/mol. Its IUPAC name is cyclopropyl-[3-[6-[4-[(2S,6R)-2-ethenyl-6-methylpiperazin-1-yl]phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]phenyl]methanol.
| Compound Name | cyclopropyl-[3-[6-[4-[(2S,6R)-2-ethenyl-6-methylpiperazin-1-yl]phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]phenyl]methanol |
|---|---|
| PubChem CID | 163541334 |
| Molecular Formula | C29H31N5O |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | cyclopropyl-[3-[6-[4-[(2S,6R)-2-ethenyl-6-methylpiperazin-1-yl]phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]phenyl]methanol |
| SMILES | C=C[C@H]1CNC[C@@H](C)N1c1ccc(-c2cnc3c(-c4cccc(C(O)C5CC5)c4)cnn3c2)cc1 |
| InChI | InChI=1S/C29H31N5O/c1-3-25-16-30-14-19(2)34(25)26-11-9-20(10-12-26)24-15-31-29-27(17-32-33(29)18-24)22-5-4-6-23(13-22)28(35)21-7-8-21/h3-6,9-13,15,17-19,21,25,28,30,35H,1,7-8,14,16H2,2H3/t19-,25+,28?/m1/s1 |
| InChIKey | FBIDFERAOQCJFY-BBDGMXPGSA-N |
| XLogP | 4.86 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|