C25H28N5O2S+ — CID 145001644
CID 145001644 (PubChem CID 145001644) has the molecular formula C25H28N5O2S+ and a molecular weight of 462.60 g/mol.
| Compound Name | CID 145001644 |
|---|---|
| PubChem CID | 145001644 |
| Molecular Formula | C25H28N5O2S+ |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | — |
| SMILES | C[C@@H]1CNC[C@H](C)N1c1ccc(-c2cnc3c(-c4cccc([S+](C)(=O)O)c4)cnn3c2)cc1 |
| InChI | InChI=1S/C25H27N5O2S/c1-17-12-26-13-18(2)30(17)22-9-7-19(8-10-22)21-14-27-25-24(15-28-29(25)16-21)20-5-4-6-23(11-20)33(3,31)32/h4-11,14-18,26H,12-13H2,1-3H3/p+1/t17-,18+ |
| InChIKey | LEHVTRVBCHTKEA-HDICACEKSA-O |
| XLogP | 4.21 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|