About CID 145001680
CID 145001680 (PubChem CID 145001680) has the molecular formula C25H27N4O2S+
and a molecular weight of 447.58 g/mol.
Molecular Properties
| Compound Name | CID 145001680 |
| PubChem CID | 145001680 |
| Molecular Formula | C25H27N4O2S+ |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | — |
| SMILES | CN1CCC(c2ccc(-c3cnc4c(-c5cccc([S+](C)(=O)O)c5)cnn4c3)cc2)CC1 |
| InChI | InChI=1S/C25H26N4O2S/c1-28-12-10-20(11-13-28)18-6-8-19(9-7-18)22-15-26-25-24(16-27-29(25)17-22)21-4-3-5-23(14-21)32(2,30)31/h3-9,14-17,20H,10-13H2,1-2H3/p+1 |
| InChIKey | BJTPRAYFSKBXPH-UHFFFAOYSA-O |
| XLogP | 4.83 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 145001680 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145001680?
The IUPAC name of CID 145001680 (CID 145001680) is not available.
What is the SMILES notation for CID 145001680?
The canonical SMILES for CID 145001680 is CN1CCC(c2ccc(-c3cnc4c(-c5cccc([S+](C)(=O)O)c5)cnn4c3)cc2)CC1.
What is the InChIKey of CID 145001680?
The InChIKey is BJTPRAYFSKBXPH-UHFFFAOYSA-O. The full InChI is InChI=1S/C25H26N4O2S/c1-28-12-10-20(11-13-28)18-6-8-19(9-7-18)22-15-26-25-24(16-27-29(25)17-22)21-4-3-5-23(14-21)32(2,30)31/h3-9,14-17,20H,10-13H2,1-2H3/p+1.
What are the key properties of CID 145001680?
CID 145001680 has a molecular weight of 447.58 g/mol, XLogP of 4.83, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145001680 is sourced from PubChem (CID 145001680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).