C25H27N4O2S+ — CID 145001680
CID 145001680 (PubChem CID 145001680) has the molecular formula C25H27N4O2S+ and a molecular weight of 447.58 g/mol.
| Compound Name | CID 145001680 |
|---|---|
| PubChem CID | 145001680 |
| Molecular Formula | C25H27N4O2S+ |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | — |
| SMILES | CN1CCC(c2ccc(-c3cnc4c(-c5cccc([S+](C)(=O)O)c5)cnn4c3)cc2)CC1 |
| InChI | InChI=1S/C25H26N4O2S/c1-28-12-10-20(11-13-28)18-6-8-19(9-7-18)22-15-26-25-24(16-27-29(25)17-22)21-4-3-5-23(14-21)32(2,30)31/h3-9,14-17,20H,10-13H2,1-2H3/p+1 |
| InChIKey | BJTPRAYFSKBXPH-UHFFFAOYSA-O |
| XLogP | 4.83 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|