C27H23N4O2S- — CID 130214307
4-[6-(4-piperidin-4-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]naphthalene-1-sulfinate (PubChem CID 130214307) has the molecular formula C27H23N4O2S- and a molecular weight of 467.57 g/mol. Its IUPAC name is 4-[6-(4-piperidin-4-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]naphthalene-1-sulfinate.
| Compound Name | 4-[6-(4-piperidin-4-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]naphthalene-1-sulfinate |
|---|---|
| PubChem CID | 130214307 |
| Molecular Formula | C27H23N4O2S- |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 4-[6-(4-piperidin-4-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]naphthalene-1-sulfinate |
| SMILES | O=S([O-])c1ccc(-c2cnn3cc(-c4ccc(C5CCNCC5)cc4)cnc23)c2ccccc12 |
| InChI | InChI=1S/C27H24N4O2S/c32-34(33)26-10-9-23(22-3-1-2-4-24(22)26)25-16-30-31-17-21(15-29-27(25)31)19-7-5-18(6-8-19)20-11-13-28-14-12-20/h1-10,15-17,20,28H,11-14H2,(H,32,33)/p-1 |
| InChIKey | HEJGFZZTDAAMPW-UHFFFAOYSA-M |
| XLogP | 4.92 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|