C25H22N6S — CID 163291474
S-[4-[6-[4-(3-aminoazetidin-3-yl)phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]naphthalen-1-yl]thiohydroxylamine (PubChem CID 163291474) has the molecular formula C25H22N6S and a molecular weight of 438.56 g/mol. Its IUPAC name is S-[4-[6-[4-(3-aminoazetidin-3-yl)phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]naphthalen-1-yl]thiohydroxylamine.
| Compound Name | S-[4-[6-[4-(3-aminoazetidin-3-yl)phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]naphthalen-1-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 163291474 |
| Molecular Formula | C25H22N6S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | S-[4-[6-[4-(3-aminoazetidin-3-yl)phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]naphthalen-1-yl]thiohydroxylamine |
| SMILES | NSc1ccc(-c2cnn3cc(-c4ccc(C5(N)CNC5)cc4)cnc23)c2ccccc12 |
| InChI | InChI=1S/C25H22N6S/c26-25(14-28-15-25)18-7-5-16(6-8-18)17-11-29-24-22(12-30-31(24)13-17)20-9-10-23(32-27)21-4-2-1-3-19(20)21/h1-13,28H,14-15,26-27H2 |
| InChIKey | ZLHUKZMZGLOQSW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 94.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|