C26H26N7OS+ — CID 140797496
CID 140797496 (PubChem CID 140797496) has the molecular formula C26H26N7OS+ and a molecular weight of 484.61 g/mol.
| Compound Name | CID 140797496 |
|---|---|
| PubChem CID | 140797496 |
| Molecular Formula | C26H26N7OS+ |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | — |
| SMILES | CN1CCN(c2ccc(-c3cnc4c(-c5ccc([SH+](N)=O)c6ccccc56)cnn4c3)cn2)CC1 |
| InChI | InChI=1S/C26H25N7OS/c1-31-10-12-32(13-11-31)25-9-6-18(14-28-25)19-15-29-26-23(16-30-33(26)17-19)21-7-8-24(35(27)34)22-5-3-2-4-20(21)22/h2-9,14-17H,10-13H2,1H3,(H2,27,34)/p+1 |
| InChIKey | IQEGKYIOAXQPIT-UHFFFAOYSA-O |
| XLogP | 3.29 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|